From Wikipedia, the free encyclopedia
Pharmaceutical drug
Biricodar |
|
ATC code | |
---|
|
1,7-di(pyridin-3-yl)heptan-4-yl (2S)-1-[oxo(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C34H41N3O7 |
---|
Molar mass | 603.716 g·mol−1 |
---|
3D model (JSmol) | |
---|
O=C(C(=O)c1cc(OC)c(OC)c(OC)c1)N4[C@H](C(=O)OC(CCCc2cccnc2)CCCc3cccnc3)CCCC4
|
InChI=1S/C34H41N3O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3/t28-/m0/s1 YKey:CGVWPQOFHSAKRR-NDEPHWFRSA-N Y
|
(verify) |
Biricodar or incel (INN, codename VX-710) was a pharmaceutical drug under development by Vertex Pharmaceuticals to help treat ovarian cancer patients, that never reached the market.
External links[edit]